C13H14FNO — CID 43178684
N-[(4-fluorophenyl)methyl]-1-(furan-2-yl)ethanamine (PubChem CID 43178684) has the molecular formula C13H14FNO and a molecular weight of 219.26 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-1-(furan-2-yl)ethanamine.
| Compound Name | N-[(4-fluorophenyl)methyl]-1-(furan-2-yl)ethanamine |
|---|---|
| PubChem CID | 43178684 |
| Molecular Formula | C13H14FNO |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-1-(furan-2-yl)ethanamine |
| SMILES | CC(NCc1ccc(F)cc1)c1ccco1 |
| InChI | InChI=1S/C13H14FNO/c1-10(13-3-2-8-16-13)15-9-11-4-6-12(14)7-5-11/h2-8,10,15H,9H2,1H3 |
| InChIKey | XEFCGUVBNPOQIQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |