C17H19BrN2 — CID 43180447
2-(3-bromophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethanamine (PubChem CID 43180447) has the molecular formula C17H19BrN2 and a molecular weight of 331.26 g/mol. Its IUPAC name is 2-(3-bromophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethanamine.
| Compound Name | 2-(3-bromophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethanamine |
|---|---|
| PubChem CID | 43180447 |
| Molecular Formula | C17H19BrN2 |
| Molecular Weight | 331.26 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 2-(3-bromophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethanamine |
| SMILES | NCC(c1cccc(Br)c1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C17H19BrN2/c18-15-8-3-6-14(11-15)17(12-19)20-10-4-7-13-5-1-2-9-16(13)20/h1-3,5-6,8-9,11,17H,4,7,10,12,19H2 |
| InChIKey | YOXNTHADDFJNLA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.26 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |