C28H36N2O5 — CID 4318093
2-[2-[(4-hydroxy-4a,5-dimethyl-2-oxo-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-3-yl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl]acetonitrile (PubChem CID 4318093) has the molecular formula C28H36N2O5 and a molecular weight of 480.61 g/mol. Its IUPAC name is 2-[2-[(4-hydroxy-4a,5-dimethyl-2-oxo-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-3-yl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl]acetonitrile.
| Compound Name | 2-[2-[(4-hydroxy-4a,5-dimethyl-2-oxo-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-3-yl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 4318093 |
| Molecular Formula | C28H36N2O5 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | 2-[2-[(4-hydroxy-4a,5-dimethyl-2-oxo-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-3-yl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl]acetonitrile |
| SMILES | COc1cc2c(cc1OC)C(CC#N)N(CC1C(=O)OC3CC4=CCCC(C)C4(C)C(O)C31)CC2 |
| InChI | InChI=1S/C28H36N2O5/c1-16-6-5-7-18-13-24-25(26(31)28(16,18)2)20(27(32)35-24)15-30-11-9-17-12-22(33-3)23(34-4)14-19(17)21(30)8-10-29/h7,12,14,16,20-21,24-26,31H,5-6,8-9,11,13,15H2,1-4H3 |
| InChIKey | AZQZQMGZJQKUPA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|