C10H14N4O — CID 43183787
2-(4-aminobutyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 43183787) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is 2-(4-aminobutyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-(4-aminobutyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 43183787 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 2-(4-aminobutyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | NCCCCn1nc2ccccn2c1=O |
| InChI | InChI=1S/C10H14N4O/c11-6-2-4-8-14-10(15)13-7-3-1-5-9(13)12-14/h1,3,5,7H,2,4,6,8,11H2 |
| InChIKey | YMLGVVVJQNRNAZ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 65.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|