About 2-(2-aminoethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one
2-(2-aminoethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 43184083) has the molecular formula C8H10N4O
and a molecular weight of 178.20 g/mol. Its IUPAC name is 2-(2-aminoethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one.
Analyze 2-(2-aminoethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one?
The IUPAC name of 2-(2-aminoethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one (CID 43184083) is 2-(2-aminoethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one.
What is the SMILES notation for 2-(2-aminoethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one?
The canonical SMILES for 2-(2-aminoethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one is NCCn1nc2ccccn2c1=O.
What is the InChIKey of 2-(2-aminoethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one?
The InChIKey is OLRMEUCJESNBHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O/c9-4-6-12-8(13)11-5-2-1-3-7(11)10-12/h1-3,5H,4,6,9H2.
What are the key properties of 2-(2-aminoethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one?
2-(2-aminoethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one has a molecular weight of 178.20 g/mol, XLogP of -0.55, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one is sourced from PubChem (CID 43184083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).