C16H27NO4 — CID 43184481
1-(4-butylcyclohexanecarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 43184481) has the molecular formula C16H27NO4 and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-(4-butylcyclohexanecarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid.
| Compound Name | 1-(4-butylcyclohexanecarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 43184481 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 1-(4-butylcyclohexanecarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid |
| SMILES | CCCCC1CCC(C(=O)N2CC(O)CC2C(=O)O)CC1 |
| InChI | InChI=1S/C16H27NO4/c1-2-3-4-11-5-7-12(8-6-11)15(19)17-10-13(18)9-14(17)16(20)21/h11-14,18H,2-10H2,1H3,(H,20,21) |
| InChIKey | QTNSMSLMNRXJCH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |