C16H17NO3 — CID 43186674
2,3-dihydro-1,4-benzodioxin-6-yl-(2-methoxyphenyl)methanamine (PubChem CID 43186674) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-yl-(2-methoxyphenyl)methanamine.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-yl-(2-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 43186674 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-yl-(2-methoxyphenyl)methanamine |
| SMILES | COc1ccccc1C(N)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H17NO3/c1-18-13-5-3-2-4-12(13)16(17)11-6-7-14-15(10-11)20-9-8-19-14/h2-7,10,16H,8-9,17H2,1H3 |
| InChIKey | OTYNNTNFNXRHQL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |