About 5-(oxiran-2-ylmethylsulfanyl)-1H-1,2,4-triazole
5-(oxiran-2-ylmethylsulfanyl)-1H-1,2,4-triazole (PubChem CID 43187871) has the molecular formula C5H7N3OS
and a molecular weight of 157.20 g/mol. Its IUPAC name is 5-(oxiran-2-ylmethylsulfanyl)-1H-1,2,4-triazole.
Molecular Properties
| Compound Name | 5-(oxiran-2-ylmethylsulfanyl)-1H-1,2,4-triazole |
| PubChem CID | 43187871 |
| Molecular Formula | C5H7N3OS |
| Molecular Weight | 157.20 g/mol |
| Exact Mass | 157.03 |
| IUPAC Name | 5-(oxiran-2-ylmethylsulfanyl)-1H-1,2,4-triazole |
| SMILES | c1n[nH]c(SCC2CO2)n1 |
| InChI | InChI=1S/C5H7N3OS/c1-4(9-1)2-10-5-6-3-7-8-5/h3-4H,1-2H2,(H,6,7,8) |
| InChIKey | NMTINDDEDPRKRA-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 54.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.20 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 5-(oxiran-2-ylmethylsulfanyl)-1H-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(oxiran-2-ylmethylsulfanyl)-1H-1,2,4-triazole?
The IUPAC name of 5-(oxiran-2-ylmethylsulfanyl)-1H-1,2,4-triazole (CID 43187871) is 5-(oxiran-2-ylmethylsulfanyl)-1H-1,2,4-triazole.
What is the SMILES notation for 5-(oxiran-2-ylmethylsulfanyl)-1H-1,2,4-triazole?
The canonical SMILES for 5-(oxiran-2-ylmethylsulfanyl)-1H-1,2,4-triazole is c1n[nH]c(SCC2CO2)n1.
What is the InChIKey of 5-(oxiran-2-ylmethylsulfanyl)-1H-1,2,4-triazole?
The InChIKey is NMTINDDEDPRKRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3OS/c1-4(9-1)2-10-5-6-3-7-8-5/h3-4H,1-2H2,(H,6,7,8).
What are the key properties of 5-(oxiran-2-ylmethylsulfanyl)-1H-1,2,4-triazole?
5-(oxiran-2-ylmethylsulfanyl)-1H-1,2,4-triazole has a molecular weight of 157.20 g/mol, XLogP of 0.30, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(oxiran-2-ylmethylsulfanyl)-1H-1,2,4-triazole is sourced from PubChem (CID 43187871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).