About 1-(methylamino)-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol
1-(methylamino)-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol (PubChem CID 43188093) has the molecular formula C6H12N4OS
and a molecular weight of 188.26 g/mol. Its IUPAC name is 1-(methylamino)-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol.
Molecular Properties
| Compound Name | 1-(methylamino)-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol |
| PubChem CID | 43188093 |
| Molecular Formula | C6H12N4OS |
| Molecular Weight | 188.26 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 1-(methylamino)-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol |
| SMILES | CNCC(O)CSc1ncn[nH]1 |
| InChI | InChI=1S/C6H12N4OS/c1-7-2-5(11)3-12-6-8-4-9-10-6/h4-5,7,11H,2-3H2,1H3,(H,8,9,10) |
| InChIKey | DEICWCGQNPXTGT-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.26 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(methylamino)-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(methylamino)-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol?
The IUPAC name of 1-(methylamino)-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol (CID 43188093) is 1-(methylamino)-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol.
What is the SMILES notation for 1-(methylamino)-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol?
The canonical SMILES for 1-(methylamino)-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol is CNCC(O)CSc1ncn[nH]1.
What is the InChIKey of 1-(methylamino)-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol?
The InChIKey is DEICWCGQNPXTGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4OS/c1-7-2-5(11)3-12-6-8-4-9-10-6/h4-5,7,11H,2-3H2,1H3,(H,8,9,10).
What are the key properties of 1-(methylamino)-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol?
1-(methylamino)-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol has a molecular weight of 188.26 g/mol, XLogP of -0.52, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(methylamino)-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol is sourced from PubChem (CID 43188093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).