About 1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)propan-2-ol
1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)propan-2-ol (PubChem CID 43188141) has the molecular formula C6H11N3OS2
and a molecular weight of 205.31 g/mol. Its IUPAC name is 1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)propan-2-ol.
Molecular Properties
| Compound Name | 1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)propan-2-ol |
| PubChem CID | 43188141 |
| Molecular Formula | C6H11N3OS2 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.03 |
| IUPAC Name | 1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)propan-2-ol |
| SMILES | CNCC(O)CSc1nncs1 |
| InChI | InChI=1S/C6H11N3OS2/c1-7-2-5(10)3-11-6-9-8-4-12-6/h4-5,7,10H,2-3H2,1H3 |
| InChIKey | QEYDKVRVOQPOKQ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)propan-2-ol?
The IUPAC name of 1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)propan-2-ol (CID 43188141) is 1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)propan-2-ol.
What is the SMILES notation for 1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)propan-2-ol?
The canonical SMILES for 1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)propan-2-ol is CNCC(O)CSc1nncs1.
What is the InChIKey of 1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)propan-2-ol?
The InChIKey is QEYDKVRVOQPOKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3OS2/c1-7-2-5(10)3-11-6-9-8-4-12-6/h4-5,7,10H,2-3H2,1H3.
What are the key properties of 1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)propan-2-ol?
1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)propan-2-ol has a molecular weight of 205.31 g/mol, XLogP of 0.21, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(methylamino)-3-(1,3,4-thiadiazol-2-ylsulfanyl)propan-2-ol is sourced from PubChem (CID 43188141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).