About methyl 2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]acetate
methyl 2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]acetate (PubChem CID 43190830) has the molecular formula C11H11ClN2O3
and a molecular weight of 254.67 g/mol. Its IUPAC name is methyl 2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]acetate.
Molecular Properties
| Compound Name | methyl 2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]acetate |
| PubChem CID | 43190830 |
| Molecular Formula | C11H11ClN2O3 |
| Molecular Weight | 254.67 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | methyl 2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]acetate |
| SMILES | COC(=O)CNC1C(=O)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C11H11ClN2O3/c1-17-9(15)5-13-10-7-4-6(12)2-3-8(7)14-11(10)16/h2-4,10,13H,5H2,1H3,(H,14,16) |
| InChIKey | SYGBUOYFIJSPSL-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.67 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]acetate?
The IUPAC name of methyl 2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]acetate (CID 43190830) is methyl 2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]acetate.
What is the SMILES notation for methyl 2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]acetate?
The canonical SMILES for methyl 2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]acetate is COC(=O)CNC1C(=O)Nc2ccc(Cl)cc21.
What is the InChIKey of methyl 2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]acetate?
The InChIKey is SYGBUOYFIJSPSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClN2O3/c1-17-9(15)5-13-10-7-4-6(12)2-3-8(7)14-11(10)16/h2-4,10,13H,5H2,1H3,(H,14,16).
What are the key properties of methyl 2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]acetate?
methyl 2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]acetate has a molecular weight of 254.67 g/mol, XLogP of 1.10, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]acetate is sourced from PubChem (CID 43190830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).