C17H28N2O2 — CID 43192108
N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-N',N',2,2-tetramethylpropane-1,3-diamine (PubChem CID 43192108) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-N',N',2,2-tetramethylpropane-1,3-diamine.
| Compound Name | N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-N',N',2,2-tetramethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 43192108 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-N',N',2,2-tetramethylpropane-1,3-diamine |
| SMILES | CC(NCC(C)(C)CN(C)C)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H28N2O2/c1-13(18-11-17(2,3)12-19(4)5)14-6-7-15-16(10-14)21-9-8-20-15/h6-7,10,13,18H,8-9,11-12H2,1-5H3 |
| InChIKey | SYBYGZIBLZBILL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |