C15H13F4NO — CID 43192576
N-[1-[2-(difluoromethoxy)phenyl]ethyl]-2,5-difluoroaniline (PubChem CID 43192576) has the molecular formula C15H13F4NO and a molecular weight of 299.27 g/mol. Its IUPAC name is N-[1-[2-(difluoromethoxy)phenyl]ethyl]-2,5-difluoroaniline.
| Compound Name | N-[1-[2-(difluoromethoxy)phenyl]ethyl]-2,5-difluoroaniline |
|---|---|
| PubChem CID | 43192576 |
| Molecular Formula | C15H13F4NO |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | N-[1-[2-(difluoromethoxy)phenyl]ethyl]-2,5-difluoroaniline |
| SMILES | CC(Nc1cc(F)ccc1F)c1ccccc1OC(F)F |
| InChI | InChI=1S/C15H13F4NO/c1-9(20-13-8-10(16)6-7-12(13)17)11-4-2-3-5-14(11)21-15(18)19/h2-9,15,20H,1H3 |
| InChIKey | AHPRXNGTDAJSDK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |