C17H30N2O2 — CID 43193475
4-[1-[5-(diethylamino)pentan-2-ylamino]ethyl]benzene-1,3-diol (PubChem CID 43193475) has the molecular formula C17H30N2O2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 4-[1-[5-(diethylamino)pentan-2-ylamino]ethyl]benzene-1,3-diol.
| Compound Name | 4-[1-[5-(diethylamino)pentan-2-ylamino]ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 43193475 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 4-[1-[5-(diethylamino)pentan-2-ylamino]ethyl]benzene-1,3-diol |
| SMILES | CCN(CC)CCCC(C)NC(C)c1ccc(O)cc1O |
| InChI | InChI=1S/C17H30N2O2/c1-5-19(6-2)11-7-8-13(3)18-14(4)16-10-9-15(20)12-17(16)21/h9-10,12-14,18,20-21H,5-8,11H2,1-4H3 |
| InChIKey | OZDHUMWOXVYCIN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|