C16H18BrNO2 — CID 43194565
4-bromo-N-[1-(2,4-dimethoxyphenyl)ethyl]aniline (PubChem CID 43194565) has the molecular formula C16H18BrNO2 and a molecular weight of 336.23 g/mol. Its IUPAC name is 4-bromo-N-[1-(2,4-dimethoxyphenyl)ethyl]aniline.
| Compound Name | 4-bromo-N-[1-(2,4-dimethoxyphenyl)ethyl]aniline |
|---|---|
| PubChem CID | 43194565 |
| Molecular Formula | C16H18BrNO2 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 4-bromo-N-[1-(2,4-dimethoxyphenyl)ethyl]aniline |
| SMILES | COc1ccc(C(C)Nc2ccc(Br)cc2)c(OC)c1 |
| InChI | InChI=1S/C16H18BrNO2/c1-11(18-13-6-4-12(17)5-7-13)15-9-8-14(19-2)10-16(15)20-3/h4-11,18H,1-3H3 |
| InChIKey | CELDDPCMGACLJX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |