C11H8NO2S- — CID 4319506
4-methyl-2-phenyl-1,3-thiazole-5-carboxylate (PubChem CID 4319506) has the molecular formula C11H8NO2S- and a molecular weight of 218.26 g/mol. Its IUPAC name is 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate.
| Compound Name | 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 4319506 |
| Molecular Formula | C11H8NO2S- |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)[O-] |
| InChI | InChI=1S/C11H9NO2S/c1-7-9(11(13)14)15-10(12-7)8-5-3-2-4-6-8/h2-6H,1H3,(H,13,14)/p-1 |
| InChIKey | CRSMRBYEBHOYRM-UHFFFAOYSA-M |
| XLogP | 1.48 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |