C15H15ClFNO2 — CID 43197289
(4-chloro-2-fluorophenyl)-(2,4-dimethoxyphenyl)methanamine (PubChem CID 43197289) has the molecular formula C15H15ClFNO2 and a molecular weight of 295.74 g/mol. Its IUPAC name is (4-chloro-2-fluorophenyl)-(2,4-dimethoxyphenyl)methanamine.
| Compound Name | (4-chloro-2-fluorophenyl)-(2,4-dimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 43197289 |
| Molecular Formula | C15H15ClFNO2 |
| Molecular Weight | 295.74 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | (4-chloro-2-fluorophenyl)-(2,4-dimethoxyphenyl)methanamine |
| SMILES | COc1ccc(C(N)c2ccc(Cl)cc2F)c(OC)c1 |
| InChI | InChI=1S/C15H15ClFNO2/c1-19-10-4-6-12(14(8-10)20-2)15(18)11-5-3-9(16)7-13(11)17/h3-8,15H,18H2,1-2H3 |
| InChIKey | YUQIOJVRGLOVNK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.74 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |