C15H21N3 — CID 43200228
2-[(1-ethylpyrrolidin-2-yl)methyl]-3H-isoindol-1-imine (PubChem CID 43200228) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-[(1-ethylpyrrolidin-2-yl)methyl]-3H-isoindol-1-imine.
| Compound Name | 2-[(1-ethylpyrrolidin-2-yl)methyl]-3H-isoindol-1-imine |
|---|---|
| PubChem CID | 43200228 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 2-[(1-ethylpyrrolidin-2-yl)methyl]-3H-isoindol-1-imine |
| SMILES | [H]/N=C1/c2ccccc2CN1CC1CCCN1CC |
| InChI | InChI=1S/C15H21N3/c1-2-17-9-5-7-13(17)11-18-10-12-6-3-4-8-14(12)15(18)16/h3-4,6,8,13,16H,2,5,7,9-11H2,1H3/b16-15- |
| InChIKey | UGJHUJLRDZFXCR-NXVVXOECSA-N |
| XLogP | 2.31 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|