About 4-(difluoromethylsulfonyl)-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid
4-(difluoromethylsulfonyl)-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid (PubChem CID 43200293) has the molecular formula C10H9F2NO5S
and a molecular weight of 293.25 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-(difluoromethylsulfonyl)-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
| PubChem CID | 43200293 |
| Molecular Formula | C10H9F2NO5S |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
| SMILES | O=C(O)C1CN(S(=O)(=O)C(F)F)c2ccccc2O1 |
| InChI | InChI=1S/C10H9F2NO5S/c11-10(12)19(16,17)13-5-8(9(14)15)18-7-4-2-1-3-6(7)13/h1-4,8,10H,5H2,(H,14,15) |
| InChIKey | OGQQLBWUZISDQL-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(difluoromethylsulfonyl)-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethylsulfonyl)-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid?
The IUPAC name of 4-(difluoromethylsulfonyl)-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid (CID 43200293) is 4-(difluoromethylsulfonyl)-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid.
What is the SMILES notation for 4-(difluoromethylsulfonyl)-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid?
The canonical SMILES for 4-(difluoromethylsulfonyl)-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid is O=C(O)C1CN(S(=O)(=O)C(F)F)c2ccccc2O1.
What is the InChIKey of 4-(difluoromethylsulfonyl)-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid?
The InChIKey is OGQQLBWUZISDQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F2NO5S/c11-10(12)19(16,17)13-5-8(9(14)15)18-7-4-2-1-3-6(7)13/h1-4,8,10H,5H2,(H,14,15).
What are the key properties of 4-(difluoromethylsulfonyl)-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid?
4-(difluoromethylsulfonyl)-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid has a molecular weight of 293.25 g/mol, XLogP of 0.89, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethylsulfonyl)-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid is sourced from PubChem (CID 43200293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).