C11H15N3O3 — CID 43200358
2-[1-(4-methyl-3-nitrophenyl)ethylamino]acetamide (PubChem CID 43200358) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-[1-(4-methyl-3-nitrophenyl)ethylamino]acetamide.
| Compound Name | 2-[1-(4-methyl-3-nitrophenyl)ethylamino]acetamide |
|---|---|
| PubChem CID | 43200358 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 2-[1-(4-methyl-3-nitrophenyl)ethylamino]acetamide |
| SMILES | Cc1ccc(C(C)NCC(N)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15N3O3/c1-7-3-4-9(5-10(7)14(16)17)8(2)13-6-11(12)15/h3-5,8,13H,6H2,1-2H3,(H2,12,15) |
| InChIKey | JVCDDWQVBSNIGT-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|