About 1-(2,5-dimethyl-1,3-thiazol-4-yl)-N-ethylethanamine
1-(2,5-dimethyl-1,3-thiazol-4-yl)-N-ethylethanamine (PubChem CID 43200501) has the molecular formula C9H16N2S
and a molecular weight of 184.31 g/mol. Its IUPAC name is 1-(2,5-dimethyl-1,3-thiazol-4-yl)-N-ethylethanamine.
Analyze 1-(2,5-dimethyl-1,3-thiazol-4-yl)-N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dimethyl-1,3-thiazol-4-yl)-N-ethylethanamine?
The IUPAC name of 1-(2,5-dimethyl-1,3-thiazol-4-yl)-N-ethylethanamine (CID 43200501) is 1-(2,5-dimethyl-1,3-thiazol-4-yl)-N-ethylethanamine.
What is the SMILES notation for 1-(2,5-dimethyl-1,3-thiazol-4-yl)-N-ethylethanamine?
The canonical SMILES for 1-(2,5-dimethyl-1,3-thiazol-4-yl)-N-ethylethanamine is CCNC(C)c1nc(C)sc1C.
What is the InChIKey of 1-(2,5-dimethyl-1,3-thiazol-4-yl)-N-ethylethanamine?
The InChIKey is MVNYMEQJXLNWLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2S/c1-5-10-6(2)9-7(3)12-8(4)11-9/h6,10H,5H2,1-4H3.
What are the key properties of 1-(2,5-dimethyl-1,3-thiazol-4-yl)-N-ethylethanamine?
1-(2,5-dimethyl-1,3-thiazol-4-yl)-N-ethylethanamine has a molecular weight of 184.31 g/mol, XLogP of 2.43, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dimethyl-1,3-thiazol-4-yl)-N-ethylethanamine is sourced from PubChem (CID 43200501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).