C18H20N4NiS4 — CID 4320080
bis((benzylideneamino)-[methylsulfanyl(sulfoniumylidene)methyl]azanide);nickel (PubChem CID 4320080) has the molecular formula C18H20N4NiS4 and a molecular weight of 479.35 g/mol. Its IUPAC name is bis((benzylideneamino)-[methylsulfanyl(sulfoniumylidene)methyl]azanide);nickel.
| Compound Name | bis((benzylideneamino)-[methylsulfanyl(sulfoniumylidene)methyl]azanide);nickel |
|---|---|
| PubChem CID | 4320080 |
| Molecular Formula | C18H20N4NiS4 |
| Molecular Weight | 479.35 g/mol |
| Exact Mass | 477.99 |
| IUPAC Name | bis((benzylideneamino)-[methylsulfanyl(sulfoniumylidene)methyl]azanide);nickel |
| SMILES | [H]/[S+]=C(/[N-]N=Cc1ccccc1)SC.[H]/[S+]=C(/[N-]N=Cc1ccccc1)SC.[Ni] |
| InChI | InChI=1S/2C9H10N2S2.Ni/c2*1-13-9(12)11-10-7-8-5-3-2-4-6-8;/h2*2-7H,1H3,(H,11,12); |
| InChIKey | YDGNUNWAEVAELN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|