C16H22N2O3 — CID 43202369
2-[[[2-(dimethylamino)-2-(furan-2-yl)ethyl]amino]methyl]-6-methoxyphenol (PubChem CID 43202369) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-[[[2-(dimethylamino)-2-(furan-2-yl)ethyl]amino]methyl]-6-methoxyphenol.
| Compound Name | 2-[[[2-(dimethylamino)-2-(furan-2-yl)ethyl]amino]methyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 43202369 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 2-[[[2-(dimethylamino)-2-(furan-2-yl)ethyl]amino]methyl]-6-methoxyphenol |
| SMILES | COc1cccc(CNCC(c2ccco2)N(C)C)c1O |
| InChI | InChI=1S/C16H22N2O3/c1-18(2)13(14-8-5-9-21-14)11-17-10-12-6-4-7-15(20-3)16(12)19/h4-9,13,17,19H,10-11H2,1-3H3 |
| InChIKey | JKYUSFLZHBGFFM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 57.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|