C18H23FN2 — CID 43203767
N-[[2-[(dimethylamino)methyl]phenyl]methyl]-1-(2-fluorophenyl)ethanamine (PubChem CID 43203767) has the molecular formula C18H23FN2 and a molecular weight of 286.39 g/mol. Its IUPAC name is N-[[2-[(dimethylamino)methyl]phenyl]methyl]-1-(2-fluorophenyl)ethanamine.
| Compound Name | N-[[2-[(dimethylamino)methyl]phenyl]methyl]-1-(2-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 43203767 |
| Molecular Formula | C18H23FN2 |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | N-[[2-[(dimethylamino)methyl]phenyl]methyl]-1-(2-fluorophenyl)ethanamine |
| SMILES | CC(NCc1ccccc1CN(C)C)c1ccccc1F |
| InChI | InChI=1S/C18H23FN2/c1-14(17-10-6-7-11-18(17)19)20-12-15-8-4-5-9-16(15)13-21(2)3/h4-11,14,20H,12-13H2,1-3H3 |
| InChIKey | MBJUFNFNRBGQEC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |