About [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate
[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate (PubChem CID 4320410) has the molecular formula C18H22N2O5S
and a molecular weight of 378.45 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate.
Molecular Properties
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate |
| PubChem CID | 4320410 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate |
| SMILES | CCN(C(=O)COC(=O)Cc1c[nH]c2ccccc12)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H22N2O5S/c1-2-20(14-7-8-26(23,24)12-14)17(21)11-25-18(22)9-13-10-19-16-6-4-3-5-15(13)16/h3-6,10,14,19H,2,7-9,11-12H2,1H3 |
| InChIKey | LXMARXRIOFJTGY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate?
The IUPAC name of [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate (CID 4320410) is [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate.
What is the SMILES notation for [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate?
The canonical SMILES for [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate is CCN(C(=O)COC(=O)Cc1c[nH]c2ccccc12)C1CCS(=O)(=O)C1.
What is the InChIKey of [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate?
The InChIKey is LXMARXRIOFJTGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O5S/c1-2-20(14-7-8-26(23,24)12-14)17(21)11-25-18(22)9-13-10-19-16-6-4-3-5-15(13)16/h3-6,10,14,19H,2,7-9,11-12H2,1H3.
What are the key properties of [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate?
[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate has a molecular weight of 378.45 g/mol, XLogP of 1.29, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate is sourced from PubChem (CID 4320410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).