C13H11BrN2OS — CID 43204711
5-bromo-3-(thiophen-2-ylmethylamino)-1,3-dihydroindol-2-one (PubChem CID 43204711) has the molecular formula C13H11BrN2OS and a molecular weight of 323.22 g/mol. Its IUPAC name is 5-bromo-3-(thiophen-2-ylmethylamino)-1,3-dihydroindol-2-one.
| Compound Name | 5-bromo-3-(thiophen-2-ylmethylamino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43204711 |
| Molecular Formula | C13H11BrN2OS |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | 5-bromo-3-(thiophen-2-ylmethylamino)-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccc(Br)cc2C1NCc1cccs1 |
| InChI | InChI=1S/C13H11BrN2OS/c14-8-3-4-11-10(6-8)12(13(17)16-11)15-7-9-2-1-5-18-9/h1-6,12,15H,7H2,(H,16,17) |
| InChIKey | BLYDSNHYCDQYDN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |