C16H21NO2S — CID 43206054
1-(2,4-dimethoxyphenyl)-N-(1-thiophen-2-ylethyl)ethanamine (PubChem CID 43206054) has the molecular formula C16H21NO2S and a molecular weight of 291.42 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-N-(1-thiophen-2-ylethyl)ethanamine.
| Compound Name | 1-(2,4-dimethoxyphenyl)-N-(1-thiophen-2-ylethyl)ethanamine |
|---|---|
| PubChem CID | 43206054 |
| Molecular Formula | C16H21NO2S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-N-(1-thiophen-2-ylethyl)ethanamine |
| SMILES | COc1ccc(C(C)NC(C)c2cccs2)c(OC)c1 |
| InChI | InChI=1S/C16H21NO2S/c1-11(17-12(2)16-6-5-9-20-16)14-8-7-13(18-3)10-15(14)19-4/h5-12,17H,1-4H3 |
| InChIKey | JHXJDWABSAJYON-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |