C15H17NO2 — CID 43206950
3-[[5-(2-methylcyclopropyl)furan-2-yl]methylamino]phenol (PubChem CID 43206950) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is 3-[[5-(2-methylcyclopropyl)furan-2-yl]methylamino]phenol.
| Compound Name | 3-[[5-(2-methylcyclopropyl)furan-2-yl]methylamino]phenol |
|---|---|
| PubChem CID | 43206950 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 3-[[5-(2-methylcyclopropyl)furan-2-yl]methylamino]phenol |
| SMILES | CC1CC1c1ccc(CNc2cccc(O)c2)o1 |
| InChI | InChI=1S/C15H17NO2/c1-10-7-14(10)15-6-5-13(18-15)9-16-11-3-2-4-12(17)8-11/h2-6,8,10,14,16-17H,7,9H2,1H3 |
| InChIKey | INLPDNXKYJYKMC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |