About (E)-4-[(1,1-dioxothiolan-3-yl)carbamoylamino]-4-oxobut-2-enoic acid
(E)-4-[(1,1-dioxothiolan-3-yl)carbamoylamino]-4-oxobut-2-enoic acid (PubChem CID 43209423) has the molecular formula C9H12N2O6S
and a molecular weight of 276.27 g/mol. Its IUPAC name is (E)-4-[(1,1-dioxothiolan-3-yl)carbamoylamino]-4-oxobut-2-enoic acid.
Molecular Properties
| Compound Name | (E)-4-[(1,1-dioxothiolan-3-yl)carbamoylamino]-4-oxobut-2-enoic acid |
| PubChem CID | 43209423 |
| Molecular Formula | C9H12N2O6S |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | (E)-4-[(1,1-dioxothiolan-3-yl)carbamoylamino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)NC(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H12N2O6S/c12-7(1-2-8(13)14)11-9(15)10-6-3-4-18(16,17)5-6/h1-2,6H,3-5H2,(H,13,14)(H2,10,11,12,15)/b2-1+ |
| InChIKey | GAKPHADHBXXQIL-OWOJBTEDSA-N |
| XLogP | -1.36 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-[(1,1-dioxothiolan-3-yl)carbamoylamino]-4-oxobut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-[(1,1-dioxothiolan-3-yl)carbamoylamino]-4-oxobut-2-enoic acid?
The IUPAC name of (E)-4-[(1,1-dioxothiolan-3-yl)carbamoylamino]-4-oxobut-2-enoic acid (CID 43209423) is (E)-4-[(1,1-dioxothiolan-3-yl)carbamoylamino]-4-oxobut-2-enoic acid.
What is the SMILES notation for (E)-4-[(1,1-dioxothiolan-3-yl)carbamoylamino]-4-oxobut-2-enoic acid?
The canonical SMILES for (E)-4-[(1,1-dioxothiolan-3-yl)carbamoylamino]-4-oxobut-2-enoic acid is O=C(O)/C=C/C(=O)NC(=O)NC1CCS(=O)(=O)C1.
What is the InChIKey of (E)-4-[(1,1-dioxothiolan-3-yl)carbamoylamino]-4-oxobut-2-enoic acid?
The InChIKey is GAKPHADHBXXQIL-OWOJBTEDSA-N. The full InChI is InChI=1S/C9H12N2O6S/c12-7(1-2-8(13)14)11-9(15)10-6-3-4-18(16,17)5-6/h1-2,6H,3-5H2,(H,13,14)(H2,10,11,12,15)/b2-1+.
What are the key properties of (E)-4-[(1,1-dioxothiolan-3-yl)carbamoylamino]-4-oxobut-2-enoic acid?
(E)-4-[(1,1-dioxothiolan-3-yl)carbamoylamino]-4-oxobut-2-enoic acid has a molecular weight of 276.27 g/mol, XLogP of -1.36, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-[(1,1-dioxothiolan-3-yl)carbamoylamino]-4-oxobut-2-enoic acid is sourced from PubChem (CID 43209423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).