C12H21NO3 — CID 43209769
1-(2-methylpentanoyl)piperidine-4-carboxylic acid (PubChem CID 43209769) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is 1-(2-methylpentanoyl)piperidine-4-carboxylic acid.
| Compound Name | 1-(2-methylpentanoyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 43209769 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 1-(2-methylpentanoyl)piperidine-4-carboxylic acid |
| SMILES | CCCC(C)C(=O)N1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C12H21NO3/c1-3-4-9(2)11(14)13-7-5-10(6-8-13)12(15)16/h9-10H,3-8H2,1-2H3,(H,15,16) |
| InChIKey | XECBUOYPFADXOF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |