C10H11ClFNO4S — CID 43210055
4-[(2-ethoxyacetyl)amino]-2-fluorobenzenesulfonyl chloride (PubChem CID 43210055) has the molecular formula C10H11ClFNO4S and a molecular weight of 295.72 g/mol. Its IUPAC name is 4-[(2-ethoxyacetyl)amino]-2-fluorobenzenesulfonyl chloride.
| Compound Name | 4-[(2-ethoxyacetyl)amino]-2-fluorobenzenesulfonyl chloride |
|---|---|
| PubChem CID | 43210055 |
| Molecular Formula | C10H11ClFNO4S |
| Molecular Weight | 295.72 g/mol |
| Exact Mass | 295.01 |
| IUPAC Name | 4-[(2-ethoxyacetyl)amino]-2-fluorobenzenesulfonyl chloride |
| SMILES | CCOCC(=O)Nc1ccc(S(=O)(=O)Cl)c(F)c1 |
| InChI | InChI=1S/C10H11ClFNO4S/c1-2-17-6-10(14)13-7-3-4-9(8(12)5-7)18(11,15)16/h3-5H,2,6H2,1H3,(H,13,14) |
| InChIKey | MHWVSINLWCCIIB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.72 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |