About 6-fluoro-1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]indole-2,3-dione
6-fluoro-1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]indole-2,3-dione (PubChem CID 43210249) has the molecular formula C12H9FN2O4
and a molecular weight of 264.21 g/mol. Its IUPAC name is 6-fluoro-1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]indole-2,3-dione.
Molecular Properties
| Compound Name | 6-fluoro-1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]indole-2,3-dione |
| PubChem CID | 43210249 |
| Molecular Formula | C12H9FN2O4 |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 6-fluoro-1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]indole-2,3-dione |
| SMILES | O=C1NCC(CN2C(=O)C(=O)c3ccc(F)cc32)O1 |
| InChI | InChI=1S/C12H9FN2O4/c13-6-1-2-8-9(3-6)15(11(17)10(8)16)5-7-4-14-12(18)19-7/h1-3,7H,4-5H2,(H,14,18) |
| InChIKey | WFWKGJJXRIYRPS-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]indole-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]indole-2,3-dione?
The IUPAC name of 6-fluoro-1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]indole-2,3-dione (CID 43210249) is 6-fluoro-1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]indole-2,3-dione.
What is the SMILES notation for 6-fluoro-1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]indole-2,3-dione?
The canonical SMILES for 6-fluoro-1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]indole-2,3-dione is O=C1NCC(CN2C(=O)C(=O)c3ccc(F)cc32)O1.
What is the InChIKey of 6-fluoro-1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]indole-2,3-dione?
The InChIKey is WFWKGJJXRIYRPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9FN2O4/c13-6-1-2-8-9(3-6)15(11(17)10(8)16)5-7-4-14-12(18)19-7/h1-3,7H,4-5H2,(H,14,18).
What are the key properties of 6-fluoro-1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]indole-2,3-dione?
6-fluoro-1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]indole-2,3-dione has a molecular weight of 264.21 g/mol, XLogP of 0.46, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]indole-2,3-dione is sourced from PubChem (CID 43210249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).