About N-(3-aminopropyl)-N,2-dimethylpiperidine-1-sulfonamide
N-(3-aminopropyl)-N,2-dimethylpiperidine-1-sulfonamide (PubChem CID 43210734) has the molecular formula C10H23N3O2S
and a molecular weight of 249.38 g/mol. Its IUPAC name is N-(3-aminopropyl)-N,2-dimethylpiperidine-1-sulfonamide.
Molecular Properties
| Compound Name | N-(3-aminopropyl)-N,2-dimethylpiperidine-1-sulfonamide |
| PubChem CID | 43210734 |
| Molecular Formula | C10H23N3O2S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | N-(3-aminopropyl)-N,2-dimethylpiperidine-1-sulfonamide |
| SMILES | CC1CCCCN1S(=O)(=O)N(C)CCCN |
| InChI | InChI=1S/C10H23N3O2S/c1-10-6-3-4-9-13(10)16(14,15)12(2)8-5-7-11/h10H,3-9,11H2,1-2H3 |
| InChIKey | SCNWKVFFGYMVPM-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-aminopropyl)-N,2-dimethylpiperidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-aminopropyl)-N,2-dimethylpiperidine-1-sulfonamide?
The IUPAC name of N-(3-aminopropyl)-N,2-dimethylpiperidine-1-sulfonamide (CID 43210734) is N-(3-aminopropyl)-N,2-dimethylpiperidine-1-sulfonamide.
What is the SMILES notation for N-(3-aminopropyl)-N,2-dimethylpiperidine-1-sulfonamide?
The canonical SMILES for N-(3-aminopropyl)-N,2-dimethylpiperidine-1-sulfonamide is CC1CCCCN1S(=O)(=O)N(C)CCCN.
What is the InChIKey of N-(3-aminopropyl)-N,2-dimethylpiperidine-1-sulfonamide?
The InChIKey is SCNWKVFFGYMVPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N3O2S/c1-10-6-3-4-9-13(10)16(14,15)12(2)8-5-7-11/h10H,3-9,11H2,1-2H3.
What are the key properties of N-(3-aminopropyl)-N,2-dimethylpiperidine-1-sulfonamide?
N-(3-aminopropyl)-N,2-dimethylpiperidine-1-sulfonamide has a molecular weight of 249.38 g/mol, XLogP of 0.39, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-aminopropyl)-N,2-dimethylpiperidine-1-sulfonamide is sourced from PubChem (CID 43210734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).