About N-(2-cyanoethyl)-N,3-dimethylpiperidine-1-sulfonamide
N-(2-cyanoethyl)-N,3-dimethylpiperidine-1-sulfonamide (PubChem CID 43210885) has the molecular formula C10H19N3O2S
and a molecular weight of 245.35 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N,3-dimethylpiperidine-1-sulfonamide.
Molecular Properties
| Compound Name | N-(2-cyanoethyl)-N,3-dimethylpiperidine-1-sulfonamide |
| PubChem CID | 43210885 |
| Molecular Formula | C10H19N3O2S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | N-(2-cyanoethyl)-N,3-dimethylpiperidine-1-sulfonamide |
| SMILES | CC1CCCN(S(=O)(=O)N(C)CCC#N)C1 |
| InChI | InChI=1S/C10H19N3O2S/c1-10-5-3-8-13(9-10)16(14,15)12(2)7-4-6-11/h10H,3-5,7-9H2,1-2H3 |
| InChIKey | NBWMZBMTTAHHTL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-cyanoethyl)-N,3-dimethylpiperidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyanoethyl)-N,3-dimethylpiperidine-1-sulfonamide?
The IUPAC name of N-(2-cyanoethyl)-N,3-dimethylpiperidine-1-sulfonamide (CID 43210885) is N-(2-cyanoethyl)-N,3-dimethylpiperidine-1-sulfonamide.
What is the SMILES notation for N-(2-cyanoethyl)-N,3-dimethylpiperidine-1-sulfonamide?
The canonical SMILES for N-(2-cyanoethyl)-N,3-dimethylpiperidine-1-sulfonamide is CC1CCCN(S(=O)(=O)N(C)CCC#N)C1.
What is the InChIKey of N-(2-cyanoethyl)-N,3-dimethylpiperidine-1-sulfonamide?
The InChIKey is NBWMZBMTTAHHTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O2S/c1-10-5-3-8-13(9-10)16(14,15)12(2)7-4-6-11/h10H,3-5,7-9H2,1-2H3.
What are the key properties of N-(2-cyanoethyl)-N,3-dimethylpiperidine-1-sulfonamide?
N-(2-cyanoethyl)-N,3-dimethylpiperidine-1-sulfonamide has a molecular weight of 245.35 g/mol, XLogP of 0.81, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyanoethyl)-N,3-dimethylpiperidine-1-sulfonamide is sourced from PubChem (CID 43210885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).