C11H15N3O4 — CID 43210965
4-methyl-2-[(6-oxo-1H-pyrazine-3-carbonyl)amino]pentanoic acid (PubChem CID 43210965) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is 4-methyl-2-[(6-oxo-1H-pyrazine-3-carbonyl)amino]pentanoic acid.
| Compound Name | 4-methyl-2-[(6-oxo-1H-pyrazine-3-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 43210965 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 4-methyl-2-[(6-oxo-1H-pyrazine-3-carbonyl)amino]pentanoic acid |
| SMILES | CC(C)CC(NC(=O)c1c[nH]c(=O)cn1)C(=O)O |
| InChI | InChI=1S/C11H15N3O4/c1-6(2)3-7(11(17)18)14-10(16)8-4-13-9(15)5-12-8/h4-7H,3H2,1-2H3,(H,13,15)(H,14,16)(H,17,18) |
| InChIKey | CUZMNSNJGKOBCS-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |