About 3-hydroxy-2-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]butanoic acid
3-hydroxy-2-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]butanoic acid (PubChem CID 43211003) has the molecular formula C8H12N2O5S
and a molecular weight of 248.26 g/mol. Its IUPAC name is 3-hydroxy-2-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]butanoic acid.
Molecular Properties
| Compound Name | 3-hydroxy-2-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]butanoic acid |
| PubChem CID | 43211003 |
| Molecular Formula | C8H12N2O5S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 3-hydroxy-2-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]butanoic acid |
| SMILES | CC(O)C(NC(=O)C1CSC(=O)N1)C(=O)O |
| InChI | InChI=1S/C8H12N2O5S/c1-3(11)5(7(13)14)10-6(12)4-2-16-8(15)9-4/h3-5,11H,2H2,1H3,(H,9,15)(H,10,12)(H,13,14) |
| InChIKey | HNXAZGDPGKPAGB-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-2-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]butanoic acid?
The IUPAC name of 3-hydroxy-2-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]butanoic acid (CID 43211003) is 3-hydroxy-2-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]butanoic acid.
What is the SMILES notation for 3-hydroxy-2-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]butanoic acid?
The canonical SMILES for 3-hydroxy-2-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]butanoic acid is CC(O)C(NC(=O)C1CSC(=O)N1)C(=O)O.
What is the InChIKey of 3-hydroxy-2-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]butanoic acid?
The InChIKey is HNXAZGDPGKPAGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O5S/c1-3(11)5(7(13)14)10-6(12)4-2-16-8(15)9-4/h3-5,11H,2H2,1H3,(H,9,15)(H,10,12)(H,13,14).
What are the key properties of 3-hydroxy-2-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]butanoic acid?
3-hydroxy-2-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]butanoic acid has a molecular weight of 248.26 g/mol, XLogP of -1.24, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]butanoic acid is sourced from PubChem (CID 43211003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).