1-[2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid

C11H16N4O3 — CID 43211111

IUPAC1-[2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid
SMILESCC(C(=O)N1CCCCC1C(=O)O)n1cncn1
InChIInChI=1S/C11H16N4O3/c1-8(15-7-12-6-13-15)10(16)14-5-3-2-4-9(14)11(17)18/h6-9H,2-5H2,1H3,(H,17,18)
InChIKeyHGZVCSKNKZNFBY-UHFFFAOYSA-N
MW252.27 g/mol
LogP0.30
Rot. Bonds3

About 1-[2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid

1-[2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid (PubChem CID 43211111) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is 1-[2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid.

Molecular Properties

Compound Name1-[2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid
PubChem CID43211111
Molecular FormulaC11H16N4O3
Molecular Weight252.27 g/mol
Exact Mass252.12
IUPAC Name1-[2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid
SMILESCC(C(=O)N1CCCCC1C(=O)O)n1cncn1
InChIInChI=1S/C11H16N4O3/c1-8(15-7-12-6-13-15)10(16)14-5-3-2-4-9(14)11(17)18/h6-9H,2-5H2,1H3,(H,17,18)
InChIKeyHGZVCSKNKZNFBY-UHFFFAOYSA-N
XLogP0.30
TPSA88.32 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.27
LogP ≤ 50.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 1-[2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid?
The IUPAC name of 1-[2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid (CID 43211111) is 1-[2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid.
What is the SMILES notation for 1-[2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid?
The canonical SMILES for 1-[2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid is CC(C(=O)N1CCCCC1C(=O)O)n1cncn1.
What is the InChIKey of 1-[2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid?
The InChIKey is HGZVCSKNKZNFBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O3/c1-8(15-7-12-6-13-15)10(16)14-5-3-2-4-9(14)11(17)18/h6-9H,2-5H2,1H3,(H,17,18).
What are the key properties of 1-[2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid?
1-[2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid has a molecular weight of 252.27 g/mol, XLogP of 0.30, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1,2,4-triazol-1-yl)propanoyl]piperidine-2-carboxylic acid is sourced from PubChem (CID 43211111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).