About 1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-2-carboxylic acid
1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-2-carboxylic acid (PubChem CID 43211121) has the molecular formula C10H13N3O4
and a molecular weight of 239.23 g/mol. Its IUPAC name is 1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-2-carboxylic acid.
Molecular Properties
| Compound Name | 1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-2-carboxylic acid |
| PubChem CID | 43211121 |
| Molecular Formula | C10H13N3O4 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1C(=O)c1c[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C10H13N3O4/c14-8(6-5-11-10(17)12-6)13-4-2-1-3-7(13)9(15)16/h5,7H,1-4H2,(H,15,16)(H2,11,12,17) |
| InChIKey | WSJYODPENMVBSO-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-2-carboxylic acid?
The IUPAC name of 1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-2-carboxylic acid (CID 43211121) is 1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-2-carboxylic acid.
What is the SMILES notation for 1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-2-carboxylic acid?
The canonical SMILES for 1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-2-carboxylic acid is O=C(O)C1CCCCN1C(=O)c1c[nH]c(=O)[nH]1.
What is the InChIKey of 1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-2-carboxylic acid?
The InChIKey is WSJYODPENMVBSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O4/c14-8(6-5-11-10(17)12-6)13-4-2-1-3-7(13)9(15)16/h5,7H,1-4H2,(H,15,16)(H2,11,12,17).
What are the key properties of 1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-2-carboxylic acid?
1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-2-carboxylic acid has a molecular weight of 239.23 g/mol, XLogP of -0.22, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperidine-2-carboxylic acid is sourced from PubChem (CID 43211121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).