About 4-(azocan-1-yl)-N'-hydroxybutanimidamide
4-(azocan-1-yl)-N'-hydroxybutanimidamide (PubChem CID 43211911) has the molecular formula C11H23N3O
and a molecular weight of 213.32 g/mol. Its IUPAC name is 4-(azocan-1-yl)-N'-hydroxybutanimidamide.
Molecular Properties
| Compound Name | 4-(azocan-1-yl)-N'-hydroxybutanimidamide |
| PubChem CID | 43211911 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 4-(azocan-1-yl)-N'-hydroxybutanimidamide |
| SMILES | N/C(CCCN1CCCCCCC1)=N\O |
| InChI | InChI=1S/C11H23N3O/c12-11(13-15)7-6-10-14-8-4-2-1-3-5-9-14/h15H,1-10H2,(H2,12,13) |
| InChIKey | ILTCXFSRHIFOTG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(azocan-1-yl)-N'-hydroxybutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(azocan-1-yl)-N'-hydroxybutanimidamide?
The IUPAC name of 4-(azocan-1-yl)-N'-hydroxybutanimidamide (CID 43211911) is 4-(azocan-1-yl)-N'-hydroxybutanimidamide.
What is the SMILES notation for 4-(azocan-1-yl)-N'-hydroxybutanimidamide?
The canonical SMILES for 4-(azocan-1-yl)-N'-hydroxybutanimidamide is N/C(CCCN1CCCCCCC1)=N\O.
What is the InChIKey of 4-(azocan-1-yl)-N'-hydroxybutanimidamide?
The InChIKey is ILTCXFSRHIFOTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3O/c12-11(13-15)7-6-10-14-8-4-2-1-3-5-9-14/h15H,1-10H2,(H2,12,13).
What are the key properties of 4-(azocan-1-yl)-N'-hydroxybutanimidamide?
4-(azocan-1-yl)-N'-hydroxybutanimidamide has a molecular weight of 213.32 g/mol, XLogP of 1.78, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azocan-1-yl)-N'-hydroxybutanimidamide is sourced from PubChem (CID 43211911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).