C9H19N3O — CID 43214516
N-methyl-2-[(1-methylpiperidin-4-yl)amino]acetamide (PubChem CID 43214516) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is N-methyl-2-[(1-methylpiperidin-4-yl)amino]acetamide.
| Compound Name | N-methyl-2-[(1-methylpiperidin-4-yl)amino]acetamide |
|---|---|
| PubChem CID | 43214516 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | N-methyl-2-[(1-methylpiperidin-4-yl)amino]acetamide |
| SMILES | CNC(=O)CNC1CCN(C)CC1 |
| InChI | InChI=1S/C9H19N3O/c1-10-9(13)7-11-8-3-5-12(2)6-4-8/h8,11H,3-7H2,1-2H3,(H,10,13) |
| InChIKey | ZTOWWPSZSFZLDA-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |