C11H13N3O — CID 43214956
2-[(3-cyanophenyl)methylamino]-N-methylacetamide (PubChem CID 43214956) has the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. Its IUPAC name is 2-[(3-cyanophenyl)methylamino]-N-methylacetamide.
| Compound Name | 2-[(3-cyanophenyl)methylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 43214956 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 2-[(3-cyanophenyl)methylamino]-N-methylacetamide |
| SMILES | CNC(=O)CNCc1cccc(C#N)c1 |
| InChI | InChI=1S/C11H13N3O/c1-13-11(15)8-14-7-10-4-2-3-9(5-10)6-12/h2-5,14H,7-8H2,1H3,(H,13,15) |
| InChIKey | PGWAQDFMGUQIQJ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |