C14H21N — CID 43222712
N-butyl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 43222712) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is N-butyl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | N-butyl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 43222712 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | N-butyl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CCCCNC1CCc2ccccc2C1 |
| InChI | InChI=1S/C14H21N/c1-2-3-10-15-14-9-8-12-6-4-5-7-13(12)11-14/h4-7,14-15H,2-3,8-11H2,1H3 |
| InChIKey | FSXXDNPGFQZQSR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|