C19H36N2 — CID 43222789
N-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2,2,6,6-tetramethylpiperidin-4-amine (PubChem CID 43222789) has the molecular formula C19H36N2 and a molecular weight of 292.51 g/mol. Its IUPAC name is N-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2,2,6,6-tetramethylpiperidin-4-amine.
| Compound Name | N-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2,2,6,6-tetramethylpiperidin-4-amine |
|---|---|
| PubChem CID | 43222789 |
| Molecular Formula | C19H36N2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | N-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2,2,6,6-tetramethylpiperidin-4-amine |
| SMILES | CC1(C)CC(NC2CCC3CCCCC3C2)CC(C)(C)N1 |
| InChI | InChI=1S/C19H36N2/c1-18(2)12-17(13-19(3,4)21-18)20-16-10-9-14-7-5-6-8-15(14)11-16/h14-17,20-21H,5-13H2,1-4H3 |
| InChIKey | OPPQBAWVVDNCHX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |