C17H33N — CID 43222947
N-heptan-2-yl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-amine (PubChem CID 43222947) has the molecular formula C17H33N and a molecular weight of 251.46 g/mol. Its IUPAC name is N-heptan-2-yl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-amine.
| Compound Name | N-heptan-2-yl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 43222947 |
| Molecular Formula | C17H33N |
| Molecular Weight | 251.46 g/mol |
| Exact Mass | 251.26 |
| IUPAC Name | N-heptan-2-yl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-amine |
| SMILES | CCCCCC(C)NC1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C17H33N/c1-6-7-8-9-13(2)18-15-12-14-10-11-17(15,5)16(14,3)4/h13-15,18H,6-12H2,1-5H3 |
| InChIKey | ZQQIUPRHAGQPMI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|