C12H15BrN2O3 — CID 43223136
N-[(4-bromo-3-nitrophenyl)methyl]-3-ethenoxypropan-1-amine (PubChem CID 43223136) has the molecular formula C12H15BrN2O3 and a molecular weight of 315.17 g/mol. Its IUPAC name is N-[(4-bromo-3-nitrophenyl)methyl]-3-ethenoxypropan-1-amine.
| Compound Name | N-[(4-bromo-3-nitrophenyl)methyl]-3-ethenoxypropan-1-amine |
|---|---|
| PubChem CID | 43223136 |
| Molecular Formula | C12H15BrN2O3 |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | N-[(4-bromo-3-nitrophenyl)methyl]-3-ethenoxypropan-1-amine |
| SMILES | C=COCCCNCc1ccc(Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H15BrN2O3/c1-2-18-7-3-6-14-9-10-4-5-11(13)12(8-10)15(16)17/h2,4-5,8,14H,1,3,6-7,9H2 |
| InChIKey | LNJJCYVQUHWXLF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|