C18H23NS — CID 43224426
3-methyl-N-[phenyl(thiophen-2-yl)methyl]cyclohexan-1-amine (PubChem CID 43224426) has the molecular formula C18H23NS and a molecular weight of 285.46 g/mol. Its IUPAC name is 3-methyl-N-[phenyl(thiophen-2-yl)methyl]cyclohexan-1-amine.
| Compound Name | 3-methyl-N-[phenyl(thiophen-2-yl)methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 43224426 |
| Molecular Formula | C18H23NS |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 3-methyl-N-[phenyl(thiophen-2-yl)methyl]cyclohexan-1-amine |
| SMILES | CC1CCCC(NC(c2ccccc2)c2cccs2)C1 |
| InChI | InChI=1S/C18H23NS/c1-14-7-5-10-16(13-14)19-18(17-11-6-12-20-17)15-8-3-2-4-9-15/h2-4,6,8-9,11-12,14,16,18-19H,5,7,10,13H2,1H3 |
| InChIKey | LGSLVZKJAGMNQV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |