C15H18ClN — CID 43225192
1-(2-bicyclo[2.2.1]hept-5-enyl)-N-[(2-chlorophenyl)methyl]methanamine (PubChem CID 43225192) has the molecular formula C15H18ClN and a molecular weight of 247.77 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]hept-5-enyl)-N-[(2-chlorophenyl)methyl]methanamine.
| Compound Name | 1-(2-bicyclo[2.2.1]hept-5-enyl)-N-[(2-chlorophenyl)methyl]methanamine |
|---|---|
| PubChem CID | 43225192 |
| Molecular Formula | C15H18ClN |
| Molecular Weight | 247.77 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]hept-5-enyl)-N-[(2-chlorophenyl)methyl]methanamine |
| SMILES | Clc1ccccc1CNCC1CC2C=CC1C2 |
| InChI | InChI=1S/C15H18ClN/c16-15-4-2-1-3-13(15)9-17-10-14-8-11-5-6-12(14)7-11/h1-6,11-12,14,17H,7-10H2 |
| InChIKey | KVSWVOMDWZEFIF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.77 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|