C18H23N — CID 43225200
N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 43225200) has the molecular formula C18H23N and a molecular weight of 253.39 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 43225200 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | C1=CC2CC1CC2CNC1CCCc2ccccc21 |
| InChI | InChI=1S/C18H23N/c1-2-6-17-14(4-1)5-3-7-18(17)19-12-16-11-13-8-9-15(16)10-13/h1-2,4,6,8-9,13,15-16,18-19H,3,5,7,10-12H2 |
| InChIKey | AOXJLVWMPGJOOK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|