C14H16IN3OS — CID 43226209
N-ethyl-N-[4-[(4-iodoanilino)methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 43226209) has the molecular formula C14H16IN3OS and a molecular weight of 401.27 g/mol. Its IUPAC name is N-ethyl-N-[4-[(4-iodoanilino)methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-ethyl-N-[4-[(4-iodoanilino)methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 43226209 |
| Molecular Formula | C14H16IN3OS |
| Molecular Weight | 401.27 g/mol |
| Exact Mass | 401.01 |
| IUPAC Name | N-ethyl-N-[4-[(4-iodoanilino)methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CCN(C(C)=O)c1nc(CNc2ccc(I)cc2)cs1 |
| InChI | InChI=1S/C14H16IN3OS/c1-3-18(10(2)19)14-17-13(9-20-14)8-16-12-6-4-11(15)5-7-12/h4-7,9,16H,3,8H2,1-2H3 |
| InChIKey | TZFZWCQTNYKNLB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.27 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|