C14H20F2N2O — CID 43226798
2-[1-(2,4-difluorophenyl)ethylamino]-N-propylpropanamide (PubChem CID 43226798) has the molecular formula C14H20F2N2O and a molecular weight of 270.32 g/mol. Its IUPAC name is 2-[1-(2,4-difluorophenyl)ethylamino]-N-propylpropanamide.
| Compound Name | 2-[1-(2,4-difluorophenyl)ethylamino]-N-propylpropanamide |
|---|---|
| PubChem CID | 43226798 |
| Molecular Formula | C14H20F2N2O |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-[1-(2,4-difluorophenyl)ethylamino]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)NC(C)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H20F2N2O/c1-4-7-17-14(19)10(3)18-9(2)12-6-5-11(15)8-13(12)16/h5-6,8-10,18H,4,7H2,1-3H3,(H,17,19) |
| InChIKey | JVXVMZWFWDYHKZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |